Cho buta-1,3-đien phản nghịch ứng cộng cùng với Br2 theo tỉ lệ mol 1:1. Số dẫn xuất đibrom (đồng phân cấu tạo cùng đồng phân hình học) nhận được là:


Bạn đang xem: Addition of bromine to buta

$CH_2 = CH - CH = CH_2 + ext Br_2xrightarrow1:,,1left< egingatheredCH_2Br - CHBr - CH = CH_2,,,,,,,,,,,,,,,,,,,,,(1) hfill \CH_2Br - CH = CH - CH_2Br,,,,,c extis,,,,,,,,,(2) hfill \CH_2Br - CH = CH - CH_2Br,,,,,trans,,(3) hfill \ endgathered ight.$


*
*
*
*
*
*
*
*

Cho các chất sau: 2-metylbut-1-en (1); 3,3-đimetylbut-1-en (2); 3-metylpent-1-en (3); 3-metylpent-2-en (4). Những hóa học làm sao là đồng phân của nhau ?


Cho các chất sau: CH2=CHCH2CH2CH=CH2; CH2=CHCH=CHCH2CH3; CH3C(CH3)=CHCH2; CH2=CHCH2CH=CH2; CH3CH2CH=CHCH2CH3; CH3C(CH3)=CHCH2CH3; CH3CH2C(CH3)=C(C2H5)CH(CH3)2; CH3CH=CHCH3.

Số chất bao gồm đồng phân hình học tập là:


Anken C4H8 gồm bao nhiêu đồng phân lúc công dụng cùng với hỗn hợp HCl chỉ cho 1 sản phẩm hữu cơ tốt nhất ?


Ba hiđrocacbon X, Y, Z tiếp nối nhau vào hàng đồng đẳng, trong những số ấy cân nặng phân tử Z gấp hai khối lượng phân tử X. Đốt cháy 0,1 mol chất Y, sản phẩm khí hấp thụ hoàn toàn vào hỗn hợp Ca(OH)2 dư, chiếm được số gam kết tủa là:


Cho hiđrocacbon X bội nghịch ứng cùng với brom (vào dung dịch) theo tỉ lệ thành phần mol 1 : 1, nhận được hóa học cơ học Y (cất 74,08% Br về khối lượng). khi X phản ứng với HBr thì nhận được hai thành phầm hữu cơ không giống nhau. Tên gọi của X là:


Để khử hoàn toàn 200 ml hỗn hợp KMnO4 0,2M tạo nên thành hóa học rắn gray clolor Đen đề xuất V lkhông nhiều khí C2H4 (sống đktc). Giá trị buổi tối tgọi của V là:


Hỗn phù hợp khí X tất cả H2 với C2H4 bao gồm tỉ kăn năn so với He là 3,75. Dẫn X qua Ni nung lạnh, nhận được các thành phần hỗn hợp khí Y tất cả tỉ kân hận so với He là 5. Hiệu suất của bội nghịch ứng hiđro hoá là:


Cho buta-1,3-đien phản bội ứng cùng với Br2 theo tỉ lệ mol 1:1. Số dẫn xuất đibrom (đồng phân cấu trúc và đồng phân hình học) nhận được là:


Cho 3,12 gam ankin X phản nghịch ứng cùng với 0,1 mol H2 (xúc tác Pd/PbCO3, to), nhận được tất cả hổn hợp Y chỉ chứa nhì hiđrocacbon. Công thức phân tử của X là:


Xem thêm: " Going Concern Là Gì - Going Concern Và Break

Cho 3,36 lít khí hiđrocacbon X (đktc) làm phản ứng trọn vẹn cùng với lượng dư dung dịch AgNO3 trong NH3, thu được 36 gam kết tủa. Công thức phân tử của X là:


Đốt cháy hoàn toàn 6,72 lít (đktc) các thành phần hỗn hợp gồm hai hiđrocacbon X với Y (MY > MX), chiếm được 1nửa lít khí CO2 (đktc) cùng 10,8 gam H2O. Công thức của X là:


Đốt cháy trọn vẹn tất cả hổn hợp M tất cả một ankan X cùng một ankin Y, chiếm được số mol CO2 thông qua số mol H2O. Thành phần xác suất về số mol của X cùng Y vào các thành phần hỗn hợp M theo lần lượt là:


Đốt cháy hoàn toàn 0,2 mol hỗn hợp X gồm một ankan và một anken, chiếm được 0,35 mol CO2 với 0,4 mol H2O. Phần trăm số mol của anken trong X là:


Đốt cháy hoàn toàn 1 lkhông nhiều tất cả hổn hợp khí gồm C2H2 cùng hiđrocacbon X ra đời 2 lít khí CO2 với 2 lít khá H2O (các thể tích khí và khá đo sinh hoạt cùng điều kiện ánh sáng, áp suất). Công thức phân tử của X là:


Dẫn 1,68 lkhông nhiều tất cả hổn hợp khí X tất cả hai hiđrocacbon vào bình đựng hỗn hợp brom (dư). Sau lúc phản ứng xẩy ra hoàn toàn, bao gồm 4 gam brom sẽ phản bội ứng cùng còn lại 1,12 lít khí. Nếu đốt cháy hoàn toàn 1,68 lít X thì hình thành 2,8 lít khí CO2. Biết các thể tích khí các đo ngơi nghỉ đktc. Công thức phân tử của nhị hiđrocacbon là:


Hỗn đúng theo X gồm tỉ kân hận so với H2 là 21,2 gồm propan, propen cùng propin. khi đốt cháy trọn vẹn 0,1 mol X, tổng trọng lượng của CO2 cùng H2O thu được là:


Cho hỗn hợp X có CH4, C2H4 và C2H2. Lấy 8,6 gam X công dụng không còn với hỗn hợp brom (dư) thì cân nặng brom phản nghịch ứng là 48 gam. Mặt không giống, ví như mang lại 13,44 lkhông nhiều (làm việc đktc) hỗn hợp khí X công dụng cùng với lượng dư hỗn hợp AgNO3 vào NH3, nhận được 36 gam kết tủa. Phần trăm thể tích của CH4 tất cả vào X là:


Hỗn hòa hợp khí X gồm 0,3 mol H2 cùng 0,1 mol vinylaxetilen. Nung X một thời hạn với xúc tác Ni nhận được các thành phần hỗn hợp khí Y gồm tỉ kăn năn so với không khí là một. Nếu mang đến toàn thể Y sục nhàn rỗi vào dung dịch brom (dư) thì bao gồm m gam brom tham gia phản nghịch ứng. Giá trị của m là:


Dẫn V lít (làm việc đktc) tất cả hổn hợp X tất cả axetilen cùng hiđro đi qua ống sđọng nung nóng, nhận được khí Y. Dẫn Y vào lượng dư AgNO3 (hoặc Ag2O) vào hỗn hợp NH3 thu được 12 gam kết tủa. Khí đi ra khỏi dung dịch phản bội ứng hoàn toản với 16 gam brom và còn lại khí Z. Đốt cháy trọn vẹn khí Z nhận được 2,24 lít khí CO2 (nghỉ ngơi đktc) với 4,5 gam nước. Giá trị của V bằng:


Đun lạnh các thành phần hỗn hợp X gồm 0,06 mol C2H2 cùng 0,04 mol H2 với xúc tác Ni, sau một thời gian nhận được tất cả hổn hợp khí Y. Dẫn cục bộ các thành phần hỗn hợp Y lội khoan thai qua bình đựng dung dịch brom (dư) thì còn sót lại 0,448 lkhông nhiều hỗn hợp khí Z (sinh sống đktc) bao gồm tỉ kân hận so với O2 là 0,5. Kân hận lượng bình hỗn hợp brom tăng là:


Đốt cháy hoàn toàn 0,16 mol tất cả hổn hợp X tất cả CH4, C2H2, C2H4 cùng C3H6, nhận được 6,272 lít CO2(đktc) cùng 6,12 gam H2O. Mặt khác 10,1 gam X làm phản ứng buổi tối đa cùng với a mol Br2 vào dung dịch. Giá trị của a là

Bài viết liên quan

Trả lời

Email của bạn sẽ không được hiển thị công khai. Các trường bắt buộc được đánh dấu *